I am not able to identify the molecule C[Mg+]. I came across it a number of times in the USPTO-50k dataset, in reactions such as the one shown below: CON(C)C(=O)c1cn(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)n1.C[Mg+]>>CC(=O)c1cn(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)n1 I searched in PubChem and MolView and cou...

I am looking to achieve isotope separation using transition states. In the rxn of dienes with halogens, based on the temperature, the dienes can create a thermodynamic product or a kinetic product. The kinetic product is reversible, while the thermodynamic product is not. This is because thermody...

I am having trouble wrapping my head around electron affinities. And the textbook explanations aren't very helpful. So, the textbook says that the 1st electron affinity is generally exothermic. The reason given is that the electron added is strongly attracted by the effective nuclear charge. In c...

The molecule $\ce{HC(=NH)OH}$ has been shown to derive from hydrogen cyanide and water (compound 7). Is it a stable compound? source: Das, T.; Ghule, S.; Vanka, K. Insights Into the Origin of Life: Did It Begin from $\ce{HCN}$ and $\ce{H_2O}$? ACS Cent. Sci. 2019, 5, 1532–1540. https://doi.org/1...